C11H16NO8P — CID 101254816
[(2R,3S,5R)-3-hydroxy-5-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 101254816) has the molecular formula C11H16NO8P and a molecular weight of 321.22 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 101254816 |
| Molecular Formula | C11H16NO8P |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(3-hydroxy-2-methyl-4-oxo-1-pyridinyl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1c(O)c(=O)ccn1[C@H]1C[C@H](O)[C@@H](COP(=O)(O)O)O1 |
| InChI | InChI=1S/C11H16NO8P/c1-6-11(15)7(13)2-3-12(6)10-4-8(14)9(20-10)5-19-21(16,17)18/h2-3,8-10,14-15H,4-5H2,1H3,(H2,16,17,18)/t8-,9+,10+/m0/s1 |
| InChIKey | GVQWPBGHMORPRT-IVZWLZJFSA-N |
| XLogP | -0.38 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|