C10H16N5O7P — CID 163654194
[(2R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 163654194) has the molecular formula C10H16N5O7P and a molecular weight of 349.24 g/mol. Its IUPAC name is [(2R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 163654194 |
| Molecular Formula | C10H16N5O7P |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | [(2R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | NC(N)=Nc1ccn([C@H]2CC(O)[C@@H](COP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C10H16N5O7P/c11-9(12)13-7-1-2-15(10(17)14-7)8-3-5(16)6(22-8)4-21-23(18,19)20/h1-2,5-6,8,16H,3-4H2,(H2,18,19,20)(H4,11,12,13,14,17)/t5?,6-,8-/m1/s1 |
| InChIKey | IOTNOWHSVSQDIC-KYVYOHOSSA-N |
| XLogP | -2.09 |
| TPSA | 195.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|