C15H22N4O5 — CID 118494877
1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(1-morpholin-4-ylethylideneamino)pyrimidin-2-one (PubChem CID 118494877) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(1-morpholin-4-ylethylideneamino)pyrimidin-2-one.
| Compound Name | 1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(1-morpholin-4-ylethylideneamino)pyrimidin-2-one |
|---|---|
| PubChem CID | 118494877 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-(1-morpholin-4-ylethylideneamino)pyrimidin-2-one |
| SMILES | C/C(=N\c1ccn([C@H]2C[C@@H](O)[C@@H](CO)O2)c(=O)n1)N1CCOCC1 |
| InChI | InChI=1S/C15H22N4O5/c1-10(18-4-6-23-7-5-18)16-13-2-3-19(15(22)17-13)14-8-11(21)12(9-20)24-14/h2-3,11-12,14,20-21H,4-9H2,1H3/b16-10+/t11-,12-,14-/m1/s1 |
| InChIKey | QJCGBLIFSWUPQW-KFEUSTOFSA-N |
| XLogP | -0.73 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|