C16H22N6O5 — CID 136994849
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(1-morpholin-4-ylethylideneamino)-1H-purin-6-one (PubChem CID 136994849) has the molecular formula C16H22N6O5 and a molecular weight of 378.39 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(1-morpholin-4-ylethylideneamino)-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(1-morpholin-4-ylethylideneamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 136994849 |
| Molecular Formula | C16H22N6O5 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-(1-morpholin-4-ylethylideneamino)-1H-purin-6-one |
| SMILES | CC(=Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1)N1CCOCC1 |
| InChI | InChI=1S/C16H22N6O5/c1-9(21-2-4-26-5-3-21)18-16-19-14-13(15(25)20-16)17-8-22(14)12-6-10(24)11(7-23)27-12/h8,10-12,23-24H,2-7H2,1H3,(H,19,20,25)/t10-,11+,12+/m0/s1 |
| InChIKey | SBGSUKMCGAEMMR-QJPTWQEYSA-N |
| XLogP | -0.86 |
| TPSA | 138.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|