C10H18N5O13P3 — CID 174005573
[[(3R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174005573) has the molecular formula C10H18N5O13P3 and a molecular weight of 509.20 g/mol. Its IUPAC name is [[(3R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(3R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174005573 |
| Molecular Formula | C10H18N5O13P3 |
| Molecular Weight | 509.20 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | [[(3R,5R)-5-[4-(diaminomethylideneamino)-2-oxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(N)=Nc1ccn([C@H]2C[C@@H](O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C10H18N5O13P3/c11-9(12)13-7-1-2-15(10(17)14-7)8-3-5(16)6(26-8)4-25-30(21,22)28-31(23,24)27-29(18,19)20/h1-2,5-6,8,16H,3-4H2,(H,21,22)(H,23,24)(H2,18,19,20)(H4,11,12,13,14,17)/t5-,6?,8-/m1/s1 |
| InChIKey | TVSCGOKENHUWRA-ONHAXZMJSA-N |
| XLogP | -1.86 |
| TPSA | 288.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.20 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|