C9H16N3O14P3 — CID 170014744
[[5-(4-aminooxy-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 170014744) has the molecular formula C9H16N3O14P3 and a molecular weight of 483.16 g/mol. Its IUPAC name is [[5-(4-aminooxy-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(4-aminooxy-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170014744 |
| Molecular Formula | C9H16N3O14P3 |
| Molecular Weight | 483.16 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | [[5-(4-aminooxy-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NOc1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/C9H16N3O14P3/c10-24-7-1-2-12(9(14)11-7)8-3-5(13)6(23-8)4-22-28(18,19)26-29(20,21)25-27(15,16)17/h1-2,5-6,8,13H,3-4,10H2,(H,18,19)(H,20,21)(H2,15,16,17) |
| InChIKey | UKNYAIRADLLYKB-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 259.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|