C13H17FNO12P3 — CID 72699252
[[(2R,3S,5R)-5-(5-fluoroindol-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 72699252) has the molecular formula C13H17FNO12P3 and a molecular weight of 491.19 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(5-fluoroindol-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(5-fluoroindol-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 72699252 |
| Molecular Formula | C13H17FNO12P3 |
| Molecular Weight | 491.19 g/mol |
| Exact Mass | 490.99 |
| IUPAC Name | [[(2R,3S,5R)-5-(5-fluoroindol-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc3cc(F)ccc32)C[C@@H]1O |
| InChI | InChI=1S/C13H17FNO12P3/c14-9-1-2-10-8(5-9)3-4-15(10)13-6-11(16)12(25-13)7-24-29(20,21)27-30(22,23)26-28(17,18)19/h1-5,11-13,16H,6-7H2,(H,20,21)(H,22,23)(H2,17,18,19)/t11-,12+,13+/m0/s1 |
| InChIKey | HOKREAXPXGANMQ-YNEHKIRRSA-N |
| XLogP | 1.77 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|