C13H18NO12P3S2 — CID 146330391
[hydroxy-[[(2R,5R)-3-hydroxy-5-(2-methyl-4-sulfanylidenethieno[3,2-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 146330391) has the molecular formula C13H18NO12P3S2 and a molecular weight of 537.34 g/mol. Its IUPAC name is [hydroxy-[[(2R,5R)-3-hydroxy-5-(2-methyl-4-sulfanylidenethieno[3,2-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,5R)-3-hydroxy-5-(2-methyl-4-sulfanylidenethieno[3,2-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 146330391 |
| Molecular Formula | C13H18NO12P3S2 |
| Molecular Weight | 537.34 g/mol |
| Exact Mass | 536.95 |
| IUPAC Name | [hydroxy-[[(2R,5R)-3-hydroxy-5-(2-methyl-4-sulfanylidenethieno[3,2-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cc2c(=S)n([C@H]3CC(O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O3)ccc2s1 |
| InChI | InChI=1S/C13H18NO12P3S2/c1-7-4-8-11(31-7)2-3-14(13(8)30)12-5-9(15)10(24-12)6-23-28(19,20)26-29(21,22)25-27(16,17)18/h2-4,9-10,12,15H,5-6H2,1H3,(H,19,20)(H,21,22)(H2,16,17,18)/t9?,10-,12-/m1/s1 |
| InChIKey | ZTLVXKARLZXMRQ-GTFYECCDSA-N |
| XLogP | 2.73 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|