C11H15N2O12P3S2 — CID 170003400
[hydroxy-[[(3R)-3-hydroxy-5-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 170003400) has the molecular formula C11H15N2O12P3S2 and a molecular weight of 524.30 g/mol. Its IUPAC name is [hydroxy-[[(3R)-3-hydroxy-5-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(3R)-3-hydroxy-5-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 170003400 |
| Molecular Formula | C11H15N2O12P3S2 |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 523.93 |
| IUPAC Name | [hydroxy-[[(3R)-3-hydroxy-5-(4-sulfanylidene-[1,3]thiazolo[5,4-c]pyridin-5-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OCC1OC(n2ccc3ncsc3c2=S)C[C@H]1O |
| InChI | InChI=1S/C11H15N2O12P3S2/c14-7-3-9(13-2-1-6-10(11(13)29)30-5-12-6)23-8(7)4-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-2,5,7-9,14H,3-4H2,(H,18,19)(H,20,21)(H2,15,16,17)/t7-,8?,9?/m1/s1 |
| InChIKey | SWMNGDMSJWJGIB-AFPNSQJFSA-N |
| XLogP | 1.82 |
| TPSA | 207.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|