C12H16NO12P3S2 — CID 121403807
[hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(7-sulfanylidenethieno[2,3-c]pyridin-6-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 121403807) has the molecular formula C12H16NO12P3S2 and a molecular weight of 523.31 g/mol. Its IUPAC name is [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(7-sulfanylidenethieno[2,3-c]pyridin-6-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(7-sulfanylidenethieno[2,3-c]pyridin-6-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 121403807 |
| Molecular Formula | C12H16NO12P3S2 |
| Molecular Weight | 523.31 g/mol |
| Exact Mass | 522.93 |
| IUPAC Name | [hydroxy-[[(2R,3R,5R)-3-hydroxy-5-(7-sulfanylidenethieno[2,3-c]pyridin-6-yl)oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2ccc3ccsc3c2=S)C[C@H]1O |
| InChI | InChI=1S/C12H16NO12P3S2/c14-8-5-10(13-3-1-7-2-4-30-11(7)12(13)29)23-9(8)6-22-27(18,19)25-28(20,21)24-26(15,16)17/h1-4,8-10,14H,5-6H2,(H,18,19)(H,20,21)(H2,15,16,17)/t8-,9-,10-/m1/s1 |
| InChIKey | DYCHFPNIHWUDHY-OPRDCNLKSA-N |
| XLogP | 2.42 |
| TPSA | 194.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|