C20H27N6O11P — CID 135506352
[(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 135506352) has the molecular formula C20H27N6O11P and a molecular weight of 558.44 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 135506352 |
| Molecular Formula | C20H27N6O11P |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | [(2R,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl] [(2R,3S,5R)-3-hydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CC1CN([C@H]2C[C@H](OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(=O)[nH]cnc54)C[C@@H]3O)[C@@H](CO)O2)C(=O)NC1=O |
| InChI | InChI=1S/C20H27N6O11P/c1-9-4-25(20(31)24-18(9)29)15-3-11(12(5-27)35-15)37-38(32,33)34-6-13-10(28)2-14(36-13)26-8-23-16-17(26)21-7-22-19(16)30/h7-15,27-28H,2-6H2,1H3,(H,32,33)(H,21,22,30)(H,24,29,31)/t9?,10-,11-,12+,13+,14+,15+/m0/s1 |
| InChIKey | HHOSUFLXFXCRLR-OUYFSLFYSA-N |
| XLogP | -1.43 |
| TPSA | 227.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|