C10H18N2O11P2 — CID 156589497
[(2R,3S,5R)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 156589497) has the molecular formula C10H18N2O11P2 and a molecular weight of 404.21 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 156589497 |
| Molecular Formula | C10H18N2O11P2 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [(2R,3S,5R)-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)-2-(phosphonooxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | CC1CN([C@H]2C[C@H](OP(=O)(O)O)[C@@H](COP(=O)(O)O)O2)C(=O)NC1=O |
| InChI | InChI=1S/C10H18N2O11P2/c1-5-3-12(10(14)11-9(5)13)8-2-6(23-25(18,19)20)7(22-8)4-21-24(15,16)17/h5-8H,2-4H2,1H3,(H,11,13,14)(H2,15,16,17)(H2,18,19,20)/t5?,6-,7+,8+/m0/s1 |
| InChIKey | GNYPWLYPFKORQA-UNYLCCJPSA-N |
| XLogP | -1.12 |
| TPSA | 192.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|