C10H18N2O12P2 — CID 45052296
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 45052296) has the molecular formula C10H18N2O12P2 and a molecular weight of 420.20 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 45052296 |
| Molecular Formula | C10H18N2O12P2 |
| Molecular Weight | 420.20 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CC1CN([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)C(=O)NC1=O |
| InChI | InChI=1S/C10H18N2O12P2/c1-4-2-12(10(16)11-8(4)15)9-7(14)6(13)5(23-9)3-22-26(20,21)24-25(17,18)19/h4-7,9,13-14H,2-3H2,1H3,(H,20,21)(H,11,15,16)(H2,17,18,19)/t4?,5-,6-,7-,9-/m1/s1 |
| InChIKey | SOZRXXZKLMCENX-KWCDMSRLSA-N |
| XLogP | -2.15 |
| TPSA | 212.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.20 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|