C9H15IN2O12P2 — CID 77282564
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-iodo-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 77282564) has the molecular formula C9H15IN2O12P2 and a molecular weight of 532.07 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-iodo-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-iodo-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 77282564 |
| Molecular Formula | C9H15IN2O12P2 |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.91 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(5-iodo-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | O=C1NC(=O)N([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)CC1I |
| InChI | InChI=1S/C9H15IN2O12P2/c10-3-1-12(9(16)11-7(3)15)8-6(14)5(13)4(23-8)2-22-26(20,21)24-25(17,18)19/h3-6,8,13-14H,1-2H2,(H,20,21)(H,11,15,16)(H2,17,18,19)/t3?,4-,5-,6-,8-/m1/s1 |
| InChIKey | FOUCRNZORJFALI-NLQUXFCRSA-N |
| XLogP | -1.99 |
| TPSA | 212.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|