C11H18N5O13P3 — CID 176526669
[[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(6R)-spiro[8H-purine-6,2'-aziridine]-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 176526669) has the molecular formula C11H18N5O13P3 and a molecular weight of 521.21 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(6R)-spiro[8H-purine-6,2'-aziridine]-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(6R)-spiro[8H-purine-6,2'-aziridine]-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 176526669 |
| Molecular Formula | C11H18N5O13P3 |
| Molecular Weight | 521.21 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | [[(2R,3S,4R,5R)-3,4-dihydroxy-5-[(6R)-spiro[8H-purine-6,2'-aziridine]-9-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](N2CN=C3C2=NC=N[C@]32CN2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H18N5O13P3/c17-6-5(1-26-31(22,23)29-32(24,25)28-30(19,20)21)27-10(7(6)18)16-4-13-8-9(16)12-3-15-11(8)2-14-11/h3,5-7,10,14,17-18H,1-2,4H2,(H,22,23)(H,24,25)(H2,19,20,21)/t5-,6-,7-,10-,11-/m1/s1 |
| InChIKey | QFCYJBXNGAOIDS-FIWAKCIFSA-N |
| XLogP | -2.77 |
| TPSA | 271.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.21 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|