C13H21N6O13P3 — CID 90265430
[[5-(9,11-dimethyl-1,3,5,7,9,10-hexazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraen-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 90265430) has the molecular formula C13H21N6O13P3 and a molecular weight of 562.26 g/mol. Its IUPAC name is [[5-(9,11-dimethyl-1,3,5,7,9,10-hexazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraen-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(9,11-dimethyl-1,3,5,7,9,10-hexazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraen-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 90265430 |
| Molecular Formula | C13H21N6O13P3 |
| Molecular Weight | 562.26 g/mol |
| Exact Mass | 562.04 |
| IUPAC Name | [[5-(9,11-dimethyl-1,3,5,7,9,10-hexazatricyclo[6.3.1.04,12]dodeca-4,6,8(12),10-tetraen-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC1=NN(C)c2ncnc3c2N1CN3C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C13H21N6O13P3/c1-6-16-17(2)11-8-12(15-4-14-11)19(5-18(6)8)13-10(21)9(20)7(30-13)3-29-34(25,26)32-35(27,28)31-33(22,23)24/h4,7,9-10,13,20-21H,3,5H2,1-2H3,(H,25,26)(H,27,28)(H2,22,23,24) |
| InChIKey | XYVSZUHVPOAHRR-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 257.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.26 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|