C10H15N4O8PS — CID 172696550
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-hydroxy-6-sulfanyl-8H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 172696550) has the molecular formula C10H15N4O8PS and a molecular weight of 382.29 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-hydroxy-6-sulfanyl-8H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-hydroxy-6-sulfanyl-8H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 172696550 |
| Molecular Formula | C10H15N4O8PS |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-hydroxy-6-sulfanyl-8H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](N2CN=C3C2=NC=NC3(O)S)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H15N4O8PS/c15-5-4(1-21-23(18,19)20)22-9(6(5)16)14-3-12-7-8(14)11-2-13-10(7,17)24/h2,4-6,9,15-17,24H,1,3H2,(H2,18,19,20)/t4-,5-,6-,9-,10?/m1/s1 |
| InChIKey | CJYHBGMTOKSAFJ-YQBTWGSQSA-N |
| XLogP | -2.73 |
| TPSA | 177.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|