C10H13N4O8P — CID 45052544
[(5R)-3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 45052544) has the molecular formula C10H13N4O8P and a molecular weight of 348.21 g/mol. Its IUPAC name is [(5R)-3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(5R)-3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 45052544 |
| Molecular Formula | C10H13N4O8P |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [(5R)-3,4-dihydroxy-5-(6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C1N=CN=C2C1N=CN2[C@@H]1OC(COP(=O)(O)O)C(O)C1O |
| InChI | InChI=1S/C10H13N4O8P/c15-6-4(1-21-23(18,19)20)22-10(7(6)16)14-3-13-5-8(14)11-2-12-9(5)17/h2-7,10,15-16H,1H2,(H2,18,19,20)/t4?,5?,6?,7?,10-/m1/s1 |
| InChIKey | AQXKGQJLGOXRBW-IQVGMVPASA-N |
| XLogP | -2.78 |
| TPSA | 173.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|