C10H12CaN5O8P — CID 171036373
calcium [3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate (PubChem CID 171036373) has the molecular formula C10H12CaN5O8P and a molecular weight of 401.29 g/mol. Its IUPAC name is calcium [3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | calcium [3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 171036373 |
| Molecular Formula | C10H12CaN5O8P |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | calcium [3,4-dihydroxy-5-(2-imino-6-oxo-5H-purin-9-yl)oxolan-2-yl]methyl phosphate |
| SMILES | [Ca+2].[H]/N=C1/N=C2C(N=CN2C2OC(COP(=O)([O-])[O-])C(O)C2O)C(=O)N1 |
| InChI | InChI=1S/C10H14N5O8P.Ca/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;/h2-6,9,16-17H,1H2,(H2,11,14,18)(H2,19,20,21);/q;+2/p-2 |
| InChIKey | LNMNHIIPGXAXIP-UHFFFAOYSA-L |
| XLogP | -4.93 |
| TPSA | 203.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|