C9H13N2Na2O9P — CID 73449524
disodium;[5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 73449524) has the molecular formula C9H13N2Na2O9P and a molecular weight of 370.16 g/mol. Its IUPAC name is disodium;[5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 73449524 |
| Molecular Formula | C9H13N2Na2O9P |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | disodium;[5-(2,4-dioxo-1,3-diazinan-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | O=C1CCN(C2OC(COP(=O)([O-])[O-])C(O)C2O)C(=O)N1.[Na+].[Na+] |
| InChI | InChI=1S/C9H15N2O9P.2Na/c12-5-1-2-11(9(15)10-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18;;/h4,6-8,13-14H,1-3H2,(H,10,12,15)(H2,16,17,18);;/q;2*+1/p-2 |
| InChIKey | PPSJGQXWLFCJJR-UHFFFAOYSA-L |
| XLogP | -9.77 |
| TPSA | 171.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | -9.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|