C9H11N2Na2O8PS — CID 22263511
disodium;[3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphate (PubChem CID 22263511) has the molecular formula C9H11N2Na2O8PS and a molecular weight of 384.21 g/mol. Its IUPAC name is disodium;[3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | disodium;[3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 22263511 |
| Molecular Formula | C9H11N2Na2O8PS |
| Molecular Weight | 384.21 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | disodium;[3,4-dihydroxy-5-(2-oxo-4-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| SMILES | O=c1[nH]c(=S)ccn1C1OC(COP(=O)([O-])[O-])C(O)C1O.[Na+].[Na+] |
| InChI | InChI=1S/C9H13N2O8PS.2Na/c12-6-4(3-18-20(15,16)17)19-8(7(6)13)11-2-1-5(21)10-9(11)14;;/h1-2,4,6-8,12-13H,3H2,(H,10,14,21)(H2,15,16,17);;/q;2*+1/p-2 |
| InChIKey | CVLFRAVGVVLGCJ-UHFFFAOYSA-L |
| XLogP | -8.62 |
| TPSA | 159.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.21 |
| LogP ≤ 5 | -8.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|