C9H13N2O10P — CID 1350
[3,4-dihydroxy-5-(2,4,6-trioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 1350) has the molecular formula C9H13N2O10P and a molecular weight of 340.18 g/mol. Its IUPAC name is [3,4-dihydroxy-5-(2,4,6-trioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [3,4-dihydroxy-5-(2,4,6-trioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 1350 |
| Molecular Formula | C9H13N2O10P |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | [3,4-dihydroxy-5-(2,4,6-trioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C1CC(=O)N(C2OC(COP(=O)(O)O)C(O)C2O)C(=O)N1 |
| InChI | InChI=1S/C9H13N2O10P/c12-4-1-5(13)11(9(16)10-4)8-7(15)6(14)3(21-8)2-20-22(17,18)19/h3,6-8,14-15H,1-2H2,(H,10,12,16)(H2,17,18,19) |
| InChIKey | AODYJUNLDJOADV-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 182.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|