C9H14N3O9P — CID 44629510
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 44629510) has the molecular formula C9H14N3O9P and a molecular weight of 339.20 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 44629510 |
| Molecular Formula | C9H14N3O9P |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-2,4-dioxo-1,3-diazinan-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [H]/N=C1\CC(=O)NC(=O)N1[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14N3O9P/c10-4-1-5(13)11-9(16)12(4)8-7(15)6(14)3(21-8)2-20-22(17,18)19/h3,6-8,10,14-15H,1-2H2,(H,11,13,16)(H2,17,18,19)/b10-4+/t3-,6-,7-,8-/m1/s1 |
| InChIKey | YUSKQFIAVNXJEN-YVODMEJYSA-N |
| XLogP | -2.54 |
| TPSA | 189.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|