C10H17N5O14P2S — CID 175015908
[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-iminopurin-3-yl]phosphonic acid;sulfuric acid (PubChem CID 175015908) has the molecular formula C10H17N5O14P2S and a molecular weight of 525.28 g/mol. Its IUPAC name is [9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-iminopurin-3-yl]phosphonic acid;sulfuric acid.
| Compound Name | [9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-iminopurin-3-yl]phosphonic acid;sulfuric acid |
|---|---|
| PubChem CID | 175015908 |
| Molecular Formula | C10H17N5O14P2S |
| Molecular Weight | 525.28 g/mol |
| Exact Mass | 525.00 |
| IUPAC Name | [9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]-6-iminopurin-3-yl]phosphonic acid;sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=c1\ncn(P(=O)(O)O)c2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15N5O10P2.H2O4S/c11-8-5-9(15(3-13-8)26(18,19)20)14(2-12-5)10-7(17)6(16)4(25-10)1-24-27(21,22)23;1-5(2,3)4/h2-4,6-7,10-11,16-17H,1H2,(H2,18,19,20)(H2,21,22,23);(H2,1,2,3,4)/b11-8-;/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | XRLSCJWWUFNCST-POBGGLFYSA-N |
| XLogP | -3.27 |
| TPSA | 308.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.28 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|