C10H14N5NaO7P+ — CID 135502120
sodium [3,4-dihydroxy-5-(6-imino-7H-purin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 135502120) has the molecular formula C10H14N5NaO7P+ and a molecular weight of 370.21 g/mol. Its IUPAC name is sodium [3,4-dihydroxy-5-(6-imino-7H-purin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | sodium [3,4-dihydroxy-5-(6-imino-7H-purin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 135502120 |
| Molecular Formula | C10H14N5NaO7P+ |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | sodium [3,4-dihydroxy-5-(6-imino-7H-purin-3-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [H]/N=c1\ncn(C2OC(COP(=O)(O)O)C(O)C2O)c2nc[nH]c12.[Na+] |
| InChI | InChI=1S/C10H14N5O7P.Na/c11-8-5-9(13-2-12-5)15(3-14-8)10-7(17)6(16)4(22-10)1-21-23(18,19)20;/h2-4,6-7,10-11,16-17H,1H2,(H,12,13)(H2,18,19,20);/q;+1/b11-8-; |
| InChIKey | AYEQVWNPXVQLRP-MKFZHGHUSA-N |
| XLogP | -5.03 |
| TPSA | 186.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | -5.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|