C15H19N10O7P — CID 69402393
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;7H-purin-6-amine (PubChem CID 69402393) has the molecular formula C15H19N10O7P and a molecular weight of 482.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;7H-purin-6-amine.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;7H-purin-6-amine |
|---|---|
| PubChem CID | 69402393 |
| Molecular Formula | C15H19N10O7P |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;7H-purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O.Nc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C10H14N5O7P.C5H5N5/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;6-4-3-5(9-1-7-3)10-2-8-4/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);1-2H,(H3,6,7,8,9,10)/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | TWYDXMNUTOKLND-MCDZGGTQSA-N |
| XLogP | -1.93 |
| TPSA | 266.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|