C14H23N6O8P — CID 158757037
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;morpholine (PubChem CID 158757037) has the molecular formula C14H23N6O8P and a molecular weight of 434.35 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;morpholine.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;morpholine |
|---|---|
| PubChem CID | 158757037 |
| Molecular Formula | C14H23N6O8P |
| Molecular Weight | 434.35 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate;morpholine |
| SMILES | C1COCCN1.Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N5O7P.C4H9NO/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(22-10)1-21-23(18,19)20;1-3-6-4-2-5-1/h2-4,6-7,10,16-17H,1H2,(H2,11,12,13)(H2,18,19,20);5H,1-4H2/t4-,6-,7-,10-;/m1./s1 |
| InChIKey | IOEVSSJBWYUXPZ-MCDZGGTQSA-N |
| XLogP | -2.26 |
| TPSA | 207.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.35 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|