C20H25N9O14P2 — CID 174600246
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphono phosphate (PubChem CID 174600246) has the molecular formula C20H25N9O14P2 and a molecular weight of 677.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphono phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphono phosphate |
|---|---|
| PubChem CID | 174600246 |
| Molecular Formula | C20H25N9O14P2 |
| Molecular Weight | 677.42 g/mol |
| Exact Mass | 677.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl phosphono phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(OC[C@H]2O[C@@H](n3cnc4c(=O)[nH]cnc43)[C@H](O)[C@@H]2O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25N9O14P2/c21-15-9-16(23-3-22-15)28(5-26-9)19-13(32)11(30)7(41-19)1-39-45(38,43-44(35,36)37)40-2-8-12(31)14(33)20(42-8)29-6-27-10-17(29)24-4-25-18(10)34/h3-8,11-14,19-20,30-33H,1-2H2,(H2,21,22,23)(H,24,25,34)(H2,35,36,37)/t7-,8-,11-,12-,13-,14-,19-,20-,45?/m1/s1 |
| InChIKey | IXRMHJWDURKENM-WKPGDNORSA-N |
| XLogP | -2.97 |
| TPSA | 334.86 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.42 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|