C10H12N5O8P — CID 151390054
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-8-oxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 151390054) has the molecular formula C10H12N5O8P and a molecular weight of 361.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-8-oxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-8-oxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 151390054 |
| Molecular Formula | C10H12N5O8P |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-imino-8-oxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [H]/N=C1\N=CN=C2C1=NC(=O)N2[C@@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H12N5O8P/c11-7-4-8(13-2-12-7)15(10(18)14-4)9-6(17)5(16)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,11,16-17H,1H2,(H2,19,20,21)/b11-7-/t3-,5-,6-,9-/m1/s1 |
| InChIKey | OUGFMYHNIBAXFD-OJPDONCTSA-N |
| XLogP | -2.16 |
| TPSA | 197.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|