C10H12N5O9P — CID 142388194
[(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-imino-6,8-dioxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 142388194) has the molecular formula C10H12N5O9P and a molecular weight of 377.21 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-imino-6,8-dioxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-imino-6,8-dioxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 142388194 |
| Molecular Formula | C10H12N5O9P |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-(2-imino-6,8-dioxopurin-9-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | [H]/N=C1/N=C2C(=NC(=O)N2[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C10H12N5O9P/c11-9-13-6-3(7(18)14-9)12-10(19)15(6)8-5(17)4(16)2(24-8)1-23-25(20,21)22/h2,4-5,8,16-17H,1H2,(H2,11,14,18)(H2,20,21,22)/t2-,4-,5-,8-/m1/s1 |
| InChIKey | YFMDZEPTKLTXHQ-UMMCILCDSA-N |
| XLogP | -3.12 |
| TPSA | 214.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|