C13H18N5O7+ — CID 150210271
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-7-(2-methoxyethyl)purin-7-ium-6,8-dione (PubChem CID 150210271) has the molecular formula C13H18N5O7+ and a molecular weight of 356.32 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-7-(2-methoxyethyl)purin-7-ium-6,8-dione.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-7-(2-methoxyethyl)purin-7-ium-6,8-dione |
|---|---|
| PubChem CID | 150210271 |
| Molecular Formula | C13H18N5O7+ |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-imino-7-(2-methoxyethyl)purin-7-ium-6,8-dione |
| SMILES | [H]/N=C1/N=C2C(=[N+](CCOC)C(=O)N2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
| InChI | InChI=1S/C13H17N5O7/c1-24-3-2-17-6-9(15-12(14)16-10(6)22)18(13(17)23)11-8(21)7(20)5(4-19)25-11/h5,7-8,11,19-21H,2-4H2,1H3,(H-,14,16,22)/p+1/t5-,7-,8-,11-/m1/s1 |
| InChIKey | FRIJWQLHHZTTDL-IOSLPCCCSA-O |
| XLogP | -3.58 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|