C11H13N5O5 — CID 177270562
9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-iminopurin-8-one (PubChem CID 177270562) has the molecular formula C11H13N5O5 and a molecular weight of 295.26 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-iminopurin-8-one.
| Compound Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-iminopurin-8-one |
|---|---|
| PubChem CID | 177270562 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 9-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-6-iminopurin-8-one |
| SMILES | [H]/N=C1\N=CN=C2C1=NC(=O)N2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C11H13N5O5/c1-20-7-6(18)4(2-17)21-10(7)16-9-5(15-11(16)19)8(12)13-3-14-9/h3-4,6-7,10,12,17-18H,2H2,1H3/b12-8-/t4-,6-,7-,10-/m1/s1 |
| InChIKey | VQOJPRGYXLMKRI-RNYZITISSA-N |
| XLogP | -1.63 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|