C20H22N10O10 — CID 162167240
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-8-one (PubChem CID 162167240) has the molecular formula C20H22N10O10 and a molecular weight of 562.46 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-8-one.
| Compound Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-8-one |
|---|---|
| PubChem CID | 162167240 |
| Molecular Formula | C20H22N10O10 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iminopurin-8-one |
| SMILES | [H]/N=C1\N=CN=C2C1=NC(=O)N2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.[H]/N=C1\N=CN=C2C1=NC(=O)N2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/2C10H11N5O5/c2*11-7-4-8(13-2-12-7)15(10(19)14-4)9-6(18)5(17)3(1-16)20-9/h2*2-3,5-6,9,11,16-18H,1H2/b2*11-7-/t2*3-,5-,6-,9-/m11/s1 |
| InChIKey | ZNHHWYIJJVQWOR-SRRZOWIESA-N |
| XLogP | -4.56 |
| TPSA | 302.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | -4.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|