C10H15NO7 — CID 175151629
1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrrolidine-2,5-dione (PubChem CID 175151629) has the molecular formula C10H15NO7 and a molecular weight of 261.23 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175151629 |
| Molecular Formula | C10H15NO7 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15NO7/c12-3-4-7(15)8(16)9(17)10(18-4)11-5(13)1-2-6(11)14/h4,7-10,12,15-17H,1-3H2/t4-,7-,8+,9-,10-/m1/s1 |
| InChIKey | LNHACKZMGNQEDX-PMZAMSJHSA-N |
| XLogP | -3.06 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|