C16H19NO6 — CID 22294337
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-3-phenylpyrrolidine-2,5-dione (PubChem CID 22294337) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-3-phenylpyrrolidine-2,5-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22294337 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methyl-3-phenylpyrrolidine-2,5-dione |
| SMILES | CC1(c2ccccc2)CC(=O)N([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C1=O |
| InChI | InChI=1S/C16H19NO6/c1-16(9-5-3-2-4-6-9)7-11(19)17(15(16)22)14-13(21)12(20)10(8-18)23-14/h2-6,10,12-14,18,20-21H,7-8H2,1H3/t10-,12-,13-,14-,16?/m1/s1 |
| InChIKey | JLTFOHYHWYBFNS-BTVNHDEBSA-N |
| XLogP | -0.86 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|