C15H17NO6 — CID 118450077
1-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]quinolin-4-one (PubChem CID 118450077) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]quinolin-4-one.
| Compound Name | 1-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]quinolin-4-one |
|---|---|
| PubChem CID | 118450077 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]quinolin-4-one |
| SMILES | O=c1ccn([C@H]2OC(CO)[C@@H](O)C(O)C2O)c2ccccc12 |
| InChI | InChI=1S/C15H17NO6/c17-7-11-12(19)13(20)14(21)15(22-11)16-6-5-10(18)8-3-1-2-4-9(8)16/h1-6,11-15,17,19-21H,7H2/t11?,12-,13?,14?,15+/m1/s1 |
| InChIKey | WOEZUHBNXRDSTF-BYYAHTNTSA-N |
| XLogP | -1.03 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |