C17H18N2O6 — CID 135488839
1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(Z)-2-hydroxy-2-phenylethenyl]pyrimidin-4-one (PubChem CID 135488839) has the molecular formula C17H18N2O6 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(Z)-2-hydroxy-2-phenylethenyl]pyrimidin-4-one.
| Compound Name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(Z)-2-hydroxy-2-phenylethenyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 135488839 |
| Molecular Formula | C17H18N2O6 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-[(Z)-2-hydroxy-2-phenylethenyl]pyrimidin-4-one |
| SMILES | O=c1ccn(C2OC(CO)C(O)C2O)c(/C=C(\O)c2ccccc2)n1 |
| InChI | InChI=1S/C17H18N2O6/c20-9-12-15(23)16(24)17(25-12)19-7-6-14(22)18-13(19)8-11(21)10-4-2-1-3-5-10/h1-8,12,15-17,20-21,23-24H,9H2/b11-8- |
| InChIKey | OVRHBNKPKMEANW-FLIBITNWSA-N |
| XLogP | -0.09 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|