C22H25NO5S — CID 59740283
(2R,3R,4S,5S,6R)-2-[3-(4-ethylphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740283) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-(4-ethylphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-(4-ethylphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740283 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-(4-ethylphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Sc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H25NO5S/c1-2-13-7-9-14(10-8-13)29-18-11-23(16-6-4-3-5-15(16)18)22-21(27)20(26)19(25)17(12-24)28-22/h3-11,17,19-22,24-27H,2,12H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | TUVBBHTUTGNWDL-MIUGBVLSSA-N |
| XLogP | 2.33 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |