C22H23ClFNO5S — CID 59740161
(2R,3R,4S,5S,6R)-2-[6-chloro-3-(4-ethylphenyl)sulfanyl-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740161) has the molecular formula C22H23ClFNO5S and a molecular weight of 467.95 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[6-chloro-3-(4-ethylphenyl)sulfanyl-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[6-chloro-3-(4-ethylphenyl)sulfanyl-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740161 |
| Molecular Formula | C22H23ClFNO5S |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[6-chloro-3-(4-ethylphenyl)sulfanyl-4-fluoroindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Sc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3cc(Cl)cc(F)c23)cc1 |
| InChI | InChI=1S/C22H23ClFNO5S/c1-2-11-3-5-13(6-4-11)31-17-9-25(15-8-12(23)7-14(24)18(15)17)22-21(29)20(28)19(27)16(10-26)30-22/h3-9,16,19-22,26-29H,2,10H2,1H3/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | KOUXTEUQCIAWCT-RECXWPGBSA-N |
| XLogP | 3.12 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |