C23H26FNO6S — CID 59739995
(2R,3R,4S,5S,6R)-2-[5-fluoro-3-[4-(2-hydroxyethyl)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739995) has the molecular formula C23H26FNO6S and a molecular weight of 463.53 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-fluoro-3-[4-(2-hydroxyethyl)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-fluoro-3-[4-(2-hydroxyethyl)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739995 |
| Molecular Formula | C23H26FNO6S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-fluoro-3-[4-(2-hydroxyethyl)phenyl]sulfanyl-7-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(F)cc2c(Sc3ccc(CCO)cc3)cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C23H26FNO6S/c1-12-8-14(24)9-16-18(32-15-4-2-13(3-5-15)6-7-26)10-25(19(12)16)23-22(30)21(29)20(28)17(11-27)31-23/h2-5,8-10,17,20-23,26-30H,6-7,11H2,1H3/t17-,20-,21+,22-,23-/m1/s1 |
| InChIKey | OAIOXQZMDSAWLF-LDBVRRDLSA-N |
| XLogP | 1.75 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |