C21H21ClFNO6S — CID 59739868
(2R,3R,4S,5S,6R)-2-[7-chloro-3-(2-fluoro-4-methoxyphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739868) has the molecular formula C21H21ClFNO6S and a molecular weight of 469.92 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[7-chloro-3-(2-fluoro-4-methoxyphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[7-chloro-3-(2-fluoro-4-methoxyphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739868 |
| Molecular Formula | C21H21ClFNO6S |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[7-chloro-3-(2-fluoro-4-methoxyphenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(Sc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(Cl)cccc23)c(F)c1 |
| InChI | InChI=1S/C21H21ClFNO6S/c1-29-10-5-6-15(13(23)7-10)31-16-8-24(17-11(16)3-2-4-12(17)22)21-20(28)19(27)18(26)14(9-25)30-21/h2-8,14,18-21,25-28H,9H2,1H3/t14-,18-,19+,20-,21-/m1/s1 |
| InChIKey | CAJPDODGSFJLJM-LNCSSOGTSA-N |
| XLogP | 2.57 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |