C22H23ClFNO6S — CID 59740253
(2R,3R,4S,5S,6R)-2-[7-chloro-3-(4-ethoxy-2-fluorophenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740253) has the molecular formula C22H23ClFNO6S and a molecular weight of 483.95 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[7-chloro-3-(4-ethoxy-2-fluorophenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[7-chloro-3-(4-ethoxy-2-fluorophenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740253 |
| Molecular Formula | C22H23ClFNO6S |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[7-chloro-3-(4-ethoxy-2-fluorophenyl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(Sc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(Cl)cccc23)c(F)c1 |
| InChI | InChI=1S/C22H23ClFNO6S/c1-2-30-11-6-7-16(14(24)8-11)32-17-9-25(18-12(17)4-3-5-13(18)23)22-21(29)20(28)19(27)15(10-26)31-22/h3-9,15,19-22,26-29H,2,10H2,1H3/t15-,19-,20+,21-,22-/m1/s1 |
| InChIKey | RFGFSLRYPUORNO-TVONUNMFSA-N |
| XLogP | 2.96 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |