C21H21F2NO6S — CID 59740271
(2R,3R,4S,5S,6R)-2-[4-fluoro-3-(2-fluoro-4-hydroxyphenyl)sulfanyl-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740271) has the molecular formula C21H21F2NO6S and a molecular weight of 453.46 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-fluoro-3-(2-fluoro-4-hydroxyphenyl)sulfanyl-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-(2-fluoro-4-hydroxyphenyl)sulfanyl-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740271 |
| Molecular Formula | C21H21F2NO6S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-(2-fluoro-4-hydroxyphenyl)sulfanyl-6-methylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc(F)c2c(Sc3ccc(O)cc3F)cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2c1 |
| InChI | InChI=1S/C21H21F2NO6S/c1-9-4-12(23)17-13(5-9)24(21-20(29)19(28)18(27)14(8-25)30-21)7-16(17)31-15-3-2-10(26)6-11(15)22/h2-7,14,18-21,25-29H,8H2,1H3/t14-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KUINPNJYGDVJCV-LNCSSOGTSA-N |
| XLogP | 2.06 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |