C24H22ClNO6S — CID 59740069
(2R,3R,4S,5S,6R)-2-[5-chloro-3-(6-hydroxynaphthalen-2-yl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59740069) has the molecular formula C24H22ClNO6S and a molecular weight of 487.96 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-3-(6-hydroxynaphthalen-2-yl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-3-(6-hydroxynaphthalen-2-yl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740069 |
| Molecular Formula | C24H22ClNO6S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-3-(6-hydroxynaphthalen-2-yl)sulfanylindol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(Sc3ccc4cc(O)ccc4c3)c3cc(Cl)ccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H22ClNO6S/c25-14-3-6-18-17(9-14)20(33-16-5-2-12-7-15(28)4-1-13(12)8-16)10-26(18)24-23(31)22(30)21(29)19(11-27)32-24/h1-10,19,21-24,27-31H,11H2/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | DHDMDEILFAFKJQ-PFKOEMKTSA-N |
| XLogP | 3.28 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |