C25H24FNO6 — CID 59739920
(2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-hydroxynaphthalen-2-yl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59739920) has the molecular formula C25H24FNO6 and a molecular weight of 453.47 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-hydroxynaphthalen-2-yl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-hydroxynaphthalen-2-yl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59739920 |
| Molecular Formula | C25H24FNO6 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[4-fluoro-3-[(6-hydroxynaphthalen-2-yl)methyl]indol-1-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(Cc3ccc4cc(O)ccc4c3)c3c(F)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H24FNO6/c26-18-2-1-3-19-21(18)16(9-13-4-5-15-10-17(29)7-6-14(15)8-13)11-27(19)25-24(32)23(31)22(30)20(12-28)33-25/h1-8,10-11,20,22-25,28-32H,9,12H2/t20-,22-,23+,24-,25-/m1/s1 |
| InChIKey | LONITCMTKLHEHU-PRDVQWLOSA-N |
| XLogP | 2.20 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |