C23H25ClFNO4 — CID 68847888
(2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]indol-1-yl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 68847888) has the molecular formula C23H25ClFNO4 and a molecular weight of 433.91 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]indol-1-yl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]indol-1-yl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 68847888 |
| Molecular Formula | C23H25ClFNO4 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethylphenyl)methyl]indol-1-yl]-5-fluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CCc1ccc(Cc2cn([C@@H]3O[C@H](CO)[C@@H](F)[C@H](O)[C@H]3O)c3cccc(Cl)c23)cc1 |
| InChI | InChI=1S/C23H25ClFNO4/c1-2-13-6-8-14(9-7-13)10-15-11-26(17-5-3-4-16(24)19(15)17)23-22(29)21(28)20(25)18(12-27)30-23/h3-9,11,18,20-23,27-29H,2,10,12H2,1H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | GTMBIFBGMSUDON-DODNOZFWSA-N |
| XLogP | 3.40 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |