C26H32ClNO7 — CID 50993790
(2R,3R,4S,5R)-2-[4-chloro-3-[[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]methyl]indol-1-yl]oxane-3,4,5-triol (PubChem CID 50993790) has the molecular formula C26H32ClNO7 and a molecular weight of 506.00 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-chloro-3-[[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]methyl]indol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[4-chloro-3-[[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]methyl]indol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50993790 |
| Molecular Formula | C26H32ClNO7 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-chloro-3-[[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]methyl]indol-1-yl]oxane-3,4,5-triol |
| SMILES | CCOCCOCCOc1ccc(Cc2cn([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c3cccc(Cl)c23)cc1 |
| InChI | InChI=1S/C26H32ClNO7/c1-2-32-10-11-33-12-13-34-19-8-6-17(7-9-19)14-18-15-28(21-5-3-4-20(27)23(18)21)26-25(31)24(30)22(29)16-35-26/h3-9,15,22,24-26,29-31H,2,10-14,16H2,1H3/t22-,24+,25-,26-/m1/s1 |
| InChIKey | SFEVCRSRCCGAEL-BIGMCNFVSA-N |
| XLogP | 2.93 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|