C21H22ClNO5 — CID 50992818
(2R,3R,4S,5R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol (PubChem CID 50992818) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50992818 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-chloro-3-[(4-methoxyphenyl)methyl]indol-1-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cn([C@@H]3OC[C@@H](O)[C@H](O)[C@H]3O)c3cccc(Cl)c23)cc1 |
| InChI | InChI=1S/C21H22ClNO5/c1-27-14-7-5-12(6-8-14)9-13-10-23(16-4-2-3-15(22)18(13)16)21-20(26)19(25)17(24)11-28-21/h2-8,10,17,19-21,24-26H,9,11H2,1H3/t17-,19+,20-,21-/m1/s1 |
| InChIKey | YNUBIFSGGSVUQL-GFOJFJKKSA-N |
| XLogP | 2.51 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |