C28H31ClN2O7 — CID 127034239
ethyl 2-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-2-oxoacetate (PubChem CID 127034239) has the molecular formula C28H31ClN2O7 and a molecular weight of 543.02 g/mol. Its IUPAC name is ethyl 2-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-2-oxoacetate.
| Compound Name | ethyl 2-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-2-oxoacetate |
|---|---|
| PubChem CID | 127034239 |
| Molecular Formula | C28H31ClN2O7 |
| Molecular Weight | 543.02 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | ethyl 2-[[(2R,3S,4S,5R,6R)-6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-3,4,5-trihydroxyoxan-2-yl]methylamino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)NC[C@H]1O[C@@H](n2cc(Cc3ccc(C4CC4)cc3)c3c(Cl)cccc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H31ClN2O7/c1-2-37-28(36)26(35)30-13-21-23(32)24(33)25(34)27(38-21)31-14-18(22-19(29)4-3-5-20(22)31)12-15-6-8-16(9-7-15)17-10-11-17/h3-9,14,17,21,23-25,27,32-34H,2,10-13H2,1H3,(H,30,35)/t21-,23-,24+,25-,27-/m1/s1 |
| InChIKey | JOMFQRSAICZEOR-VRCQNKPTSA-N |
| XLogP | 2.42 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.02 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|