C27H32ClN3O2S — CID 123845628
1-[[6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-4-hydroxyoxan-2-yl]methyl]-3-ethylthiourea (PubChem CID 123845628) has the molecular formula C27H32ClN3O2S and a molecular weight of 498.09 g/mol. Its IUPAC name is 1-[[6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-4-hydroxyoxan-2-yl]methyl]-3-ethylthiourea.
| Compound Name | 1-[[6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-4-hydroxyoxan-2-yl]methyl]-3-ethylthiourea |
|---|---|
| PubChem CID | 123845628 |
| Molecular Formula | C27H32ClN3O2S |
| Molecular Weight | 498.09 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 1-[[6-[4-chloro-3-[(4-cyclopropylphenyl)methyl]indol-1-yl]-4-hydroxyoxan-2-yl]methyl]-3-ethylthiourea |
| SMILES | CCNC(=S)NCC1CC(O)CC(n2cc(Cc3ccc(C4CC4)cc3)c3c(Cl)cccc32)O1 |
| InChI | InChI=1S/C27H32ClN3O2S/c1-2-29-27(34)30-15-22-13-21(32)14-25(33-22)31-16-20(26-23(28)4-3-5-24(26)31)12-17-6-8-18(9-7-17)19-10-11-19/h3-9,16,19,21-22,25,32H,2,10-15H2,1H3,(H2,29,30,34) |
| InChIKey | LZKWRBCJOPRWIU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.09 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|